C21H26O8 — CID 134236367
4-[4-(2-methyl-6-prop-2-enoyloxyhexoxy)-4-oxobutanoyl]oxybenzoic acid (PubChem CID 134236367) has the molecular formula C21H26O8 and a molecular weight of 406.43 g/mol. Its IUPAC name is 4-[4-(2-methyl-6-prop-2-enoyloxyhexoxy)-4-oxobutanoyl]oxybenzoic acid.
| Compound Name | 4-[4-(2-methyl-6-prop-2-enoyloxyhexoxy)-4-oxobutanoyl]oxybenzoic acid |
|---|---|
| PubChem CID | 134236367 |
| Molecular Formula | C21H26O8 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 4-[4-(2-methyl-6-prop-2-enoyloxyhexoxy)-4-oxobutanoyl]oxybenzoic acid |
| SMILES | C=CC(=O)OCCCCC(C)COC(=O)CCC(=O)Oc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C21H26O8/c1-3-18(22)27-13-5-4-6-15(2)14-28-19(23)11-12-20(24)29-17-9-7-16(8-10-17)21(25)26/h3,7-10,15H,1,4-6,11-14H2,2H3,(H,25,26) |
| InChIKey | IXPFCPRKYDYDKA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|