C17H20O6 — CID 67856211
4-[(3R)-3-methyl-6-prop-2-enoyloxyhexanoyl]oxybenzoic acid (PubChem CID 67856211) has the molecular formula C17H20O6 and a molecular weight of 320.34 g/mol. Its IUPAC name is 4-[(3R)-3-methyl-6-prop-2-enoyloxyhexanoyl]oxybenzoic acid.
| Compound Name | 4-[(3R)-3-methyl-6-prop-2-enoyloxyhexanoyl]oxybenzoic acid |
|---|---|
| PubChem CID | 67856211 |
| Molecular Formula | C17H20O6 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 4-[(3R)-3-methyl-6-prop-2-enoyloxyhexanoyl]oxybenzoic acid |
| SMILES | C=CC(=O)OCCC[C@@H](C)CC(=O)Oc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C17H20O6/c1-3-15(18)22-10-4-5-12(2)11-16(19)23-14-8-6-13(7-9-14)17(20)21/h3,6-9,12H,1,4-5,10-11H2,2H3,(H,20,21)/t12-/m1/s1 |
| InChIKey | YEPIBJQYXGEFLY-GFCCVEGCSA-N |
| XLogP | 2.83 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|