C16H18O6 — CID 89276570
4-(4-buta-1,3-dien-2-yloxybutoxycarbonyloxy)benzoic acid (PubChem CID 89276570) has the molecular formula C16H18O6 and a molecular weight of 306.31 g/mol. Its IUPAC name is 4-(4-buta-1,3-dien-2-yloxybutoxycarbonyloxy)benzoic acid.
| Compound Name | 4-(4-buta-1,3-dien-2-yloxybutoxycarbonyloxy)benzoic acid |
|---|---|
| PubChem CID | 89276570 |
| Molecular Formula | C16H18O6 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 4-(4-buta-1,3-dien-2-yloxybutoxycarbonyloxy)benzoic acid |
| SMILES | C=CC(=C)OCCCCOC(=O)Oc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C16H18O6/c1-3-12(2)20-10-4-5-11-21-16(19)22-14-8-6-13(7-9-14)15(17)18/h3,6-9H,1-2,4-5,10-11H2,(H,17,18) |
| InChIKey | SPDPZOIGKIJOHO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|