C20H34CuN4O6 — CID 59856363
copper bis([1-carboxy-5-(2-methylprop-2-enoylamino)pentyl]azanide) (PubChem CID 59856363) has the molecular formula C20H34CuN4O6 and a molecular weight of 490.06 g/mol. Its IUPAC name is copper bis([1-carboxy-5-(2-methylprop-2-enoylamino)pentyl]azanide).
| Compound Name | copper bis([1-carboxy-5-(2-methylprop-2-enoylamino)pentyl]azanide) |
|---|---|
| PubChem CID | 59856363 |
| Molecular Formula | C20H34CuN4O6 |
| Molecular Weight | 490.06 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | copper bis([1-carboxy-5-(2-methylprop-2-enoylamino)pentyl]azanide) |
| SMILES | C=C(C)C(=O)NCCCCC([NH-])C(=O)O.C=C(C)C(=O)NCCCCC([NH-])C(=O)O.[Cu+2] |
| InChI | InChI=1S/2C10H17N2O3.Cu/c2*1-7(2)9(13)12-6-4-3-5-8(11)10(14)15;/h2*8,11H,1,3-6H2,2H3,(H,12,13)(H,14,15);/q2*-1;+2 |
| InChIKey | HKNCOXPSBGWXSJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 180.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.06 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|