C7H11NO4S — CID 173290774
3-(2-methylprop-2-enoylamino)prop-1-ene-1-sulfonic acid (PubChem CID 173290774) has the molecular formula C7H11NO4S and a molecular weight of 205.23 g/mol. Its IUPAC name is 3-(2-methylprop-2-enoylamino)prop-1-ene-1-sulfonic acid.
| Compound Name | 3-(2-methylprop-2-enoylamino)prop-1-ene-1-sulfonic acid |
|---|---|
| PubChem CID | 173290774 |
| Molecular Formula | C7H11NO4S |
| Molecular Weight | 205.23 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | 3-(2-methylprop-2-enoylamino)prop-1-ene-1-sulfonic acid |
| SMILES | C=C(C)C(=O)NCC=CS(=O)(=O)O |
| InChI | InChI=1S/C7H11NO4S/c1-6(2)7(9)8-4-3-5-13(10,11)12/h3,5H,1,4H2,2H3,(H,8,9)(H,10,11,12) |
| InChIKey | BEELPVFJUKNIPO-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.23 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|