C15H30ClN3O2 — CID 175371989
N-propan-2-ylprop-2-enamide;trimethyl-[3-(prop-2-enoylamino)propyl]azanium;chloride (PubChem CID 175371989) has the molecular formula C15H30ClN3O2 and a molecular weight of 319.88 g/mol. Its IUPAC name is N-propan-2-ylprop-2-enamide;trimethyl-[3-(prop-2-enoylamino)propyl]azanium;chloride.
| Compound Name | N-propan-2-ylprop-2-enamide;trimethyl-[3-(prop-2-enoylamino)propyl]azanium;chloride |
|---|---|
| PubChem CID | 175371989 |
| Molecular Formula | C15H30ClN3O2 |
| Molecular Weight | 319.88 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | N-propan-2-ylprop-2-enamide;trimethyl-[3-(prop-2-enoylamino)propyl]azanium;chloride |
| SMILES | C=CC(=O)NC(C)C.C=CC(=O)NCCC[N+](C)(C)C.[Cl-] |
| InChI | InChI=1S/C9H18N2O.C6H11NO.ClH/c1-5-9(12)10-7-6-8-11(2,3)4;1-4-6(8)7-5(2)3;/h5H,1,6-8H2,2-4H3;4-5H,1H2,2-3H3,(H,7,8);1H |
| InChIKey | MLSCWVNPYXRZBP-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.88 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|