C12H22N3O2+ — CID 87735347
3,3-bis(prop-2-enoylamino)propyl-trimethylazanium (PubChem CID 87735347) has the molecular formula C12H22N3O2+ and a molecular weight of 240.33 g/mol. Its IUPAC name is 3,3-bis(prop-2-enoylamino)propyl-trimethylazanium.
| Compound Name | 3,3-bis(prop-2-enoylamino)propyl-trimethylazanium |
|---|---|
| PubChem CID | 87735347 |
| Molecular Formula | C12H22N3O2+ |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 3,3-bis(prop-2-enoylamino)propyl-trimethylazanium |
| SMILES | C=CC(=O)NC(CC[N+](C)(C)C)NC(=O)C=C |
| InChI | InChI=1S/C12H21N3O2/c1-6-11(16)13-10(14-12(17)7-2)8-9-15(3,4)5/h6-7,10H,1-2,8-9H2,3-5H3,(H-,13,14,16,17)/p+1 |
| InChIKey | OAHIITIZNQCZJY-UHFFFAOYSA-O |
| XLogP | 0.01 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|