C21H24N2O3 — CID 85325370
N-hydroxy-6-(5-naphthalen-1-ylpenta-2,4-dienoylamino)hexanamide (PubChem CID 85325370) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is N-hydroxy-6-(5-naphthalen-1-ylpenta-2,4-dienoylamino)hexanamide.
| Compound Name | N-hydroxy-6-(5-naphthalen-1-ylpenta-2,4-dienoylamino)hexanamide |
|---|---|
| PubChem CID | 85325370 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | N-hydroxy-6-(5-naphthalen-1-ylpenta-2,4-dienoylamino)hexanamide |
| SMILES | O=C(C=CC=Cc1cccc2ccccc12)NCCCCCC(=O)NO |
| InChI | InChI=1S/C21H24N2O3/c24-20(22-16-7-1-2-15-21(25)23-26)14-6-4-10-18-12-8-11-17-9-3-5-13-19(17)18/h3-6,8-14,26H,1-2,7,15-16H2,(H,22,24)(H,23,25) |
| InChIKey | IFDKTBYIWUSLJA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|