C20H24N2O3 — CID 58248767
(2E,4E)-N-(7-hydroxy-6-oxoheptyl)-5-(1H-indol-3-yl)penta-2,4-dienamide (PubChem CID 58248767) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is (2E,4E)-N-(7-hydroxy-6-oxoheptyl)-5-(1H-indol-3-yl)penta-2,4-dienamide.
| Compound Name | (2E,4E)-N-(7-hydroxy-6-oxoheptyl)-5-(1H-indol-3-yl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 58248767 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | (2E,4E)-N-(7-hydroxy-6-oxoheptyl)-5-(1H-indol-3-yl)penta-2,4-dienamide |
| SMILES | O=C(CO)CCCCCNC(=O)/C=C/C=C/c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H24N2O3/c23-15-17(24)9-2-1-7-13-21-20(25)12-6-3-8-16-14-22-19-11-5-4-10-18(16)19/h3-6,8,10-12,14,22-23H,1-2,7,9,13,15H2,(H,21,25)/b8-3+,12-6+ |
| InChIKey | ICTFZXVFKWFMMY-YSVFXRPESA-N |
| XLogP | 2.98 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|