C18H15ClN2O — CID 73338848
N-[(2-chlorophenyl)methyl]-3-(1H-indol-3-yl)prop-2-enamide (PubChem CID 73338848) has the molecular formula C18H15ClN2O and a molecular weight of 310.78 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-3-(1H-indol-3-yl)prop-2-enamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-3-(1H-indol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 73338848 |
| Molecular Formula | C18H15ClN2O |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-3-(1H-indol-3-yl)prop-2-enamide |
| SMILES | O=C(C=Cc1c[nH]c2ccccc12)NCc1ccccc1Cl |
| InChI | InChI=1S/C18H15ClN2O/c19-16-7-3-1-5-14(16)12-21-18(22)10-9-13-11-20-17-8-4-2-6-15(13)17/h1-11,20H,12H2,(H,21,22) |
| InChIKey | BENBCHOHVJWBLQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|