C17H22N2OS — CID 3860366
N-(2-tert-butylsulfanylethyl)-3-(1H-indol-3-yl)prop-2-enamide (PubChem CID 3860366) has the molecular formula C17H22N2OS and a molecular weight of 302.44 g/mol. Its IUPAC name is N-(2-tert-butylsulfanylethyl)-3-(1H-indol-3-yl)prop-2-enamide.
| Compound Name | N-(2-tert-butylsulfanylethyl)-3-(1H-indol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 3860366 |
| Molecular Formula | C17H22N2OS |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | N-(2-tert-butylsulfanylethyl)-3-(1H-indol-3-yl)prop-2-enamide |
| SMILES | CC(C)(C)SCCNC(=O)C=Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C17H22N2OS/c1-17(2,3)21-11-10-18-16(20)9-8-13-12-19-15-7-5-4-6-14(13)15/h4-9,12,19H,10-11H2,1-3H3,(H,18,20) |
| InChIKey | DXFAXKWRCDMBDZ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|