C27H28ClN7O2 — CID 68534510
N-[2-[[6-(2-acetamidoethylamino)-2-(4-chlorophenyl)pyrimidin-4-yl]amino]ethyl]-3-(1H-indol-3-yl)prop-2-enamide (PubChem CID 68534510) has the molecular formula C27H28ClN7O2 and a molecular weight of 518.02 g/mol. Its IUPAC name is N-[2-[[6-(2-acetamidoethylamino)-2-(4-chlorophenyl)pyrimidin-4-yl]amino]ethyl]-3-(1H-indol-3-yl)prop-2-enamide.
| Compound Name | N-[2-[[6-(2-acetamidoethylamino)-2-(4-chlorophenyl)pyrimidin-4-yl]amino]ethyl]-3-(1H-indol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 68534510 |
| Molecular Formula | C27H28ClN7O2 |
| Molecular Weight | 518.02 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | N-[2-[[6-(2-acetamidoethylamino)-2-(4-chlorophenyl)pyrimidin-4-yl]amino]ethyl]-3-(1H-indol-3-yl)prop-2-enamide |
| SMILES | CC(=O)NCCNc1cc(NCCNC(=O)C=Cc2c[nH]c3ccccc23)nc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C27H28ClN7O2/c1-18(36)29-12-13-30-24-16-25(35-27(34-24)19-6-9-21(28)10-7-19)31-14-15-32-26(37)11-8-20-17-33-23-5-3-2-4-22(20)23/h2-11,16-17,33H,12-15H2,1H3,(H,29,36)(H,32,37)(H2,30,31,34,35) |
| InChIKey | YHGQATJNZSZXOR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 123.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.02 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|