C25H28ClN7O3 — CID 22378999
N-[2-[2-[[6-(2-acetamidoethylamino)-2-phenylpyrimidin-4-yl]amino]ethylamino]-2-oxoethyl]-4-chlorobenzamide (PubChem CID 22378999) has the molecular formula C25H28ClN7O3 and a molecular weight of 510.00 g/mol. Its IUPAC name is N-[2-[2-[[6-(2-acetamidoethylamino)-2-phenylpyrimidin-4-yl]amino]ethylamino]-2-oxoethyl]-4-chlorobenzamide.
| Compound Name | N-[2-[2-[[6-(2-acetamidoethylamino)-2-phenylpyrimidin-4-yl]amino]ethylamino]-2-oxoethyl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 22378999 |
| Molecular Formula | C25H28ClN7O3 |
| Molecular Weight | 510.00 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | N-[2-[2-[[6-(2-acetamidoethylamino)-2-phenylpyrimidin-4-yl]amino]ethylamino]-2-oxoethyl]-4-chlorobenzamide |
| SMILES | CC(=O)NCCNc1cc(NCCNC(=O)CNC(=O)c2ccc(Cl)cc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C25H28ClN7O3/c1-17(34)27-11-12-28-21-15-22(33-24(32-21)18-5-3-2-4-6-18)29-13-14-30-23(35)16-31-25(36)19-7-9-20(26)10-8-19/h2-10,15H,11-14,16H2,1H3,(H,27,34)(H,30,35)(H,31,36)(H2,28,29,32,33) |
| InChIKey | RHCZTSSVJRLRQR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 137.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.00 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|