C25H30N6O4 — CID 22379042
N-[2-[[6-(2-acetamidoethylamino)-2-phenylpyrimidin-4-yl]amino]ethyl]-2-(4-hydroxy-3-methoxyphenyl)acetamide (PubChem CID 22379042) has the molecular formula C25H30N6O4 and a molecular weight of 478.55 g/mol. Its IUPAC name is N-[2-[[6-(2-acetamidoethylamino)-2-phenylpyrimidin-4-yl]amino]ethyl]-2-(4-hydroxy-3-methoxyphenyl)acetamide.
| Compound Name | N-[2-[[6-(2-acetamidoethylamino)-2-phenylpyrimidin-4-yl]amino]ethyl]-2-(4-hydroxy-3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 22379042 |
| Molecular Formula | C25H30N6O4 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | N-[2-[[6-(2-acetamidoethylamino)-2-phenylpyrimidin-4-yl]amino]ethyl]-2-(4-hydroxy-3-methoxyphenyl)acetamide |
| SMILES | COc1cc(CC(=O)NCCNc2cc(NCCNC(C)=O)nc(-c3ccccc3)n2)ccc1O |
| InChI | InChI=1S/C25H30N6O4/c1-17(32)26-10-11-27-22-16-23(31-25(30-22)19-6-4-3-5-7-19)28-12-13-29-24(34)15-18-8-9-20(33)21(14-18)35-2/h3-9,14,16,33H,10-13,15H2,1-2H3,(H,26,32)(H,29,34)(H2,27,28,30,31) |
| InChIKey | IZSDQHNCPZLQMR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 137.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|