C25H28N6O3 — CID 22379172
N-[6-(2-acetamidoethylamino)-2-phenylpyrimidin-4-yl]-N'-methyl-N'-(2-phenylethyl)oxamide (PubChem CID 22379172) has the molecular formula C25H28N6O3 and a molecular weight of 460.54 g/mol. Its IUPAC name is N-[6-(2-acetamidoethylamino)-2-phenylpyrimidin-4-yl]-N'-methyl-N'-(2-phenylethyl)oxamide.
| Compound Name | N-[6-(2-acetamidoethylamino)-2-phenylpyrimidin-4-yl]-N'-methyl-N'-(2-phenylethyl)oxamide |
|---|---|
| PubChem CID | 22379172 |
| Molecular Formula | C25H28N6O3 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | N-[6-(2-acetamidoethylamino)-2-phenylpyrimidin-4-yl]-N'-methyl-N'-(2-phenylethyl)oxamide |
| SMILES | CC(=O)NCCNc1cc(NC(=O)C(=O)N(C)CCc2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C25H28N6O3/c1-18(32)26-14-15-27-21-17-22(29-23(28-21)20-11-7-4-8-12-20)30-24(33)25(34)31(2)16-13-19-9-5-3-6-10-19/h3-12,17H,13-16H2,1-2H3,(H,26,32)(H2,27,28,29,30,33) |
| InChIKey | OCHAJCPRJKVCCB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|