C27H32FN7O2 — CID 22378930
N-[6-(2-acetamidoethylamino)-2-phenylpyrimidin-4-yl]-2-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]acetamide (PubChem CID 22378930) has the molecular formula C27H32FN7O2 and a molecular weight of 505.60 g/mol. Its IUPAC name is N-[6-(2-acetamidoethylamino)-2-phenylpyrimidin-4-yl]-2-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]acetamide.
| Compound Name | N-[6-(2-acetamidoethylamino)-2-phenylpyrimidin-4-yl]-2-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 22378930 |
| Molecular Formula | C27H32FN7O2 |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.26 |
| IUPAC Name | N-[6-(2-acetamidoethylamino)-2-phenylpyrimidin-4-yl]-2-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]acetamide |
| SMILES | CC(=O)NCCNc1cc(NC(=O)CN2CCN(Cc3cccc(F)c3)CC2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C27H32FN7O2/c1-20(36)29-10-11-30-24-17-25(33-27(32-24)22-7-3-2-4-8-22)31-26(37)19-35-14-12-34(13-15-35)18-21-6-5-9-23(28)16-21/h2-9,16-17H,10-15,18-19H2,1H3,(H,29,36)(H2,30,31,32,33,37) |
| InChIKey | GXCYREYIPJIWEN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|