C28H35N7O2 — CID 174477799
N-[2-[2-(2-acetamidoethylamino)phenyl]pyrimidin-4-yl]-2-[4-(2-phenylethyl)piperazin-1-yl]acetamide (PubChem CID 174477799) has the molecular formula C28H35N7O2 and a molecular weight of 501.64 g/mol. Its IUPAC name is N-[2-[2-(2-acetamidoethylamino)phenyl]pyrimidin-4-yl]-2-[4-(2-phenylethyl)piperazin-1-yl]acetamide.
| Compound Name | N-[2-[2-(2-acetamidoethylamino)phenyl]pyrimidin-4-yl]-2-[4-(2-phenylethyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 174477799 |
| Molecular Formula | C28H35N7O2 |
| Molecular Weight | 501.64 g/mol |
| Exact Mass | 501.29 |
| IUPAC Name | N-[2-[2-(2-acetamidoethylamino)phenyl]pyrimidin-4-yl]-2-[4-(2-phenylethyl)piperazin-1-yl]acetamide |
| SMILES | CC(=O)NCCNc1ccccc1-c1nccc(NC(=O)CN2CCN(CCc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C28H35N7O2/c1-22(36)29-14-15-30-25-10-6-5-9-24(25)28-31-13-11-26(33-28)32-27(37)21-35-19-17-34(18-20-35)16-12-23-7-3-2-4-8-23/h2-11,13,30H,12,14-21H2,1H3,(H,29,36)(H,31,32,33,37) |
| InChIKey | MYFTVSBUZAEWOY-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.64 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|