C27H32N6O3 — CID 174477926
N-[2-[2-(2-acetamidoethylamino)phenyl]pyrimidin-4-yl]-2-(4-phenoxypiperidin-1-yl)acetamide (PubChem CID 174477926) has the molecular formula C27H32N6O3 and a molecular weight of 488.59 g/mol. Its IUPAC name is N-[2-[2-(2-acetamidoethylamino)phenyl]pyrimidin-4-yl]-2-(4-phenoxypiperidin-1-yl)acetamide.
| Compound Name | N-[2-[2-(2-acetamidoethylamino)phenyl]pyrimidin-4-yl]-2-(4-phenoxypiperidin-1-yl)acetamide |
|---|---|
| PubChem CID | 174477926 |
| Molecular Formula | C27H32N6O3 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | N-[2-[2-(2-acetamidoethylamino)phenyl]pyrimidin-4-yl]-2-(4-phenoxypiperidin-1-yl)acetamide |
| SMILES | CC(=O)NCCNc1ccccc1-c1nccc(NC(=O)CN2CCC(Oc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C27H32N6O3/c1-20(34)28-15-16-29-24-10-6-5-9-23(24)27-30-14-11-25(32-27)31-26(35)19-33-17-12-22(13-18-33)36-21-7-3-2-4-8-21/h2-11,14,22,29H,12-13,15-19H2,1H3,(H,28,34)(H,30,31,32,35) |
| InChIKey | AFHVZWIOGXFUIA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|