C27H32N6O2 — CID 22379084
N-[6-(2-acetamidoethylamino)-2-phenylpyrimidin-4-yl]-2-(4-phenylpiperidin-1-yl)acetamide (PubChem CID 22379084) has the molecular formula C27H32N6O2 and a molecular weight of 472.59 g/mol. Its IUPAC name is N-[6-(2-acetamidoethylamino)-2-phenylpyrimidin-4-yl]-2-(4-phenylpiperidin-1-yl)acetamide.
| Compound Name | N-[6-(2-acetamidoethylamino)-2-phenylpyrimidin-4-yl]-2-(4-phenylpiperidin-1-yl)acetamide |
|---|---|
| PubChem CID | 22379084 |
| Molecular Formula | C27H32N6O2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | N-[6-(2-acetamidoethylamino)-2-phenylpyrimidin-4-yl]-2-(4-phenylpiperidin-1-yl)acetamide |
| SMILES | CC(=O)NCCNc1cc(NC(=O)CN2CCC(c3ccccc3)CC2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C27H32N6O2/c1-20(34)28-14-15-29-24-18-25(32-27(31-24)23-10-6-3-7-11-23)30-26(35)19-33-16-12-22(13-17-33)21-8-4-2-5-9-21/h2-11,18,22H,12-17,19H2,1H3,(H,28,34)(H2,29,30,31,32,35) |
| InChIKey | RASRKBITIJZDJW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|