C23H31N7O4 — CID 22378844
N-[6-(2-acetamidoethylamino)-2-phenylpyrimidin-4-yl]-2-[4-(2-methoxyethyl)piperazin-1-yl]-2-oxoacetamide (PubChem CID 22378844) has the molecular formula C23H31N7O4 and a molecular weight of 469.55 g/mol. Its IUPAC name is N-[6-(2-acetamidoethylamino)-2-phenylpyrimidin-4-yl]-2-[4-(2-methoxyethyl)piperazin-1-yl]-2-oxoacetamide.
| Compound Name | N-[6-(2-acetamidoethylamino)-2-phenylpyrimidin-4-yl]-2-[4-(2-methoxyethyl)piperazin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 22378844 |
| Molecular Formula | C23H31N7O4 |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | N-[6-(2-acetamidoethylamino)-2-phenylpyrimidin-4-yl]-2-[4-(2-methoxyethyl)piperazin-1-yl]-2-oxoacetamide |
| SMILES | COCCN1CCN(C(=O)C(=O)Nc2cc(NCCNC(C)=O)nc(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C23H31N7O4/c1-17(31)24-8-9-25-19-16-20(27-21(26-19)18-6-4-3-5-7-18)28-22(32)23(33)30-12-10-29(11-13-30)14-15-34-2/h3-7,16H,8-15H2,1-2H3,(H,24,31)(H2,25,26,27,28,32) |
| InChIKey | SPKLMEIZEHXRKU-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 128.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|