C25H28Cl2N8O2 — CID 22378710
N-[6-(2-acetamidoethylamino)-2-phenylpyrimidin-4-yl]-2-[4-(3,5-dichloro-4-pyridinyl)piperazin-1-yl]acetamide (PubChem CID 22378710) has the molecular formula C25H28Cl2N8O2 and a molecular weight of 543.46 g/mol. Its IUPAC name is N-[6-(2-acetamidoethylamino)-2-phenylpyrimidin-4-yl]-2-[4-(3,5-dichloro-4-pyridinyl)piperazin-1-yl]acetamide.
| Compound Name | N-[6-(2-acetamidoethylamino)-2-phenylpyrimidin-4-yl]-2-[4-(3,5-dichloro-4-pyridinyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 22378710 |
| Molecular Formula | C25H28Cl2N8O2 |
| Molecular Weight | 543.46 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | N-[6-(2-acetamidoethylamino)-2-phenylpyrimidin-4-yl]-2-[4-(3,5-dichloro-4-pyridinyl)piperazin-1-yl]acetamide |
| SMILES | CC(=O)NCCNc1cc(NC(=O)CN2CCN(c3c(Cl)cncc3Cl)CC2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C25H28Cl2N8O2/c1-17(36)29-7-8-30-21-13-22(33-25(32-21)18-5-3-2-4-6-18)31-23(37)16-34-9-11-35(12-10-34)24-19(26)14-28-15-20(24)27/h2-6,13-15H,7-12,16H2,1H3,(H,29,36)(H2,30,31,32,33,37) |
| InChIKey | YNPBAYJUQYCCMA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|