C22H29N7O4 — CID 22379236
N-[6-(2-acetamidoethylamino)-2-phenylpyrimidin-4-yl]-2-[4-(2-hydroxyethyl)piperazin-1-yl]-2-oxoacetamide (PubChem CID 22379236) has the molecular formula C22H29N7O4 and a molecular weight of 455.52 g/mol. Its IUPAC name is N-[6-(2-acetamidoethylamino)-2-phenylpyrimidin-4-yl]-2-[4-(2-hydroxyethyl)piperazin-1-yl]-2-oxoacetamide.
| Compound Name | N-[6-(2-acetamidoethylamino)-2-phenylpyrimidin-4-yl]-2-[4-(2-hydroxyethyl)piperazin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 22379236 |
| Molecular Formula | C22H29N7O4 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | N-[6-(2-acetamidoethylamino)-2-phenylpyrimidin-4-yl]-2-[4-(2-hydroxyethyl)piperazin-1-yl]-2-oxoacetamide |
| SMILES | CC(=O)NCCNc1cc(NC(=O)C(=O)N2CCN(CCO)CC2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H29N7O4/c1-16(31)23-7-8-24-18-15-19(26-20(25-18)17-5-3-2-4-6-17)27-21(32)22(33)29-11-9-28(10-12-29)13-14-30/h2-6,15,30H,7-14H2,1H3,(H,23,31)(H2,24,25,26,27,32) |
| InChIKey | VOUACUGDMFUNOS-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 139.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|