C24H27ClN6O3 — CID 22378746
N-[2-[[6-(2-acetamidoethylamino)-2-(4-chlorophenyl)pyrimidin-4-yl]amino]ethyl]-2-hydroxy-2-phenylacetamide (PubChem CID 22378746) has the molecular formula C24H27ClN6O3 and a molecular weight of 482.97 g/mol. Its IUPAC name is N-[2-[[6-(2-acetamidoethylamino)-2-(4-chlorophenyl)pyrimidin-4-yl]amino]ethyl]-2-hydroxy-2-phenylacetamide.
| Compound Name | N-[2-[[6-(2-acetamidoethylamino)-2-(4-chlorophenyl)pyrimidin-4-yl]amino]ethyl]-2-hydroxy-2-phenylacetamide |
|---|---|
| PubChem CID | 22378746 |
| Molecular Formula | C24H27ClN6O3 |
| Molecular Weight | 482.97 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | N-[2-[[6-(2-acetamidoethylamino)-2-(4-chlorophenyl)pyrimidin-4-yl]amino]ethyl]-2-hydroxy-2-phenylacetamide |
| SMILES | CC(=O)NCCNc1cc(NCCNC(=O)C(O)c2ccccc2)nc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C24H27ClN6O3/c1-16(32)26-11-12-27-20-15-21(31-23(30-20)18-7-9-19(25)10-8-18)28-13-14-29-24(34)22(33)17-5-3-2-4-6-17/h2-10,15,22,33H,11-14H2,1H3,(H,26,32)(H,29,34)(H2,27,28,30,31) |
| InChIKey | BWZLEBWDWUHIEY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 128.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.97 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|