C27H29Cl2N7O3 — CID 22353535
N-[2-[4-[6-(2-acetamidoethylamino)-2-(4-chlorophenyl)pyrimidin-4-yl]piperazin-1-yl]-2-oxoethyl]-4-chlorobenzamide (PubChem CID 22353535) has the molecular formula C27H29Cl2N7O3 and a molecular weight of 570.48 g/mol. Its IUPAC name is N-[2-[4-[6-(2-acetamidoethylamino)-2-(4-chlorophenyl)pyrimidin-4-yl]piperazin-1-yl]-2-oxoethyl]-4-chlorobenzamide.
| Compound Name | N-[2-[4-[6-(2-acetamidoethylamino)-2-(4-chlorophenyl)pyrimidin-4-yl]piperazin-1-yl]-2-oxoethyl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 22353535 |
| Molecular Formula | C27H29Cl2N7O3 |
| Molecular Weight | 570.48 g/mol |
| Exact Mass | 569.17 |
| IUPAC Name | N-[2-[4-[6-(2-acetamidoethylamino)-2-(4-chlorophenyl)pyrimidin-4-yl]piperazin-1-yl]-2-oxoethyl]-4-chlorobenzamide |
| SMILES | CC(=O)NCCNc1cc(N2CCN(C(=O)CNC(=O)c3ccc(Cl)cc3)CC2)nc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C27H29Cl2N7O3/c1-18(37)30-10-11-31-23-16-24(34-26(33-23)19-2-6-21(28)7-3-19)35-12-14-36(15-13-35)25(38)17-32-27(39)20-4-8-22(29)9-5-20/h2-9,16H,10-15,17H2,1H3,(H,30,37)(H,32,39)(H,31,33,34) |
| InChIKey | ONEYBQBXYSBYNQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 119.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.48 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|