C27H27ClN6O2S — CID 22353385
N-[2-[[6-[4-(1-benzothiophene-2-carbonyl)piperazin-1-yl]-2-(4-chlorophenyl)pyrimidin-4-yl]amino]ethyl]acetamide (PubChem CID 22353385) has the molecular formula C27H27ClN6O2S and a molecular weight of 535.07 g/mol. Its IUPAC name is N-[2-[[6-[4-(1-benzothiophene-2-carbonyl)piperazin-1-yl]-2-(4-chlorophenyl)pyrimidin-4-yl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[6-[4-(1-benzothiophene-2-carbonyl)piperazin-1-yl]-2-(4-chlorophenyl)pyrimidin-4-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 22353385 |
| Molecular Formula | C27H27ClN6O2S |
| Molecular Weight | 535.07 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | N-[2-[[6-[4-(1-benzothiophene-2-carbonyl)piperazin-1-yl]-2-(4-chlorophenyl)pyrimidin-4-yl]amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNc1cc(N2CCN(C(=O)c3cc4ccccc4s3)CC2)nc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C27H27ClN6O2S/c1-18(35)29-10-11-30-24-17-25(32-26(31-24)19-6-8-21(28)9-7-19)33-12-14-34(15-13-33)27(36)23-16-20-4-2-3-5-22(20)37-23/h2-9,16-17H,10-15H2,1H3,(H,29,35)(H,30,31,32) |
| InChIKey | UIBNRAKGSJBYPQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.07 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|