C23H25N7O4S — CID 22353338
N-[2-[[6-[4-(5-nitrothiophene-3-carbonyl)piperazin-1-yl]-2-phenylpyrimidin-4-yl]amino]ethyl]acetamide (PubChem CID 22353338) has the molecular formula C23H25N7O4S and a molecular weight of 495.57 g/mol. Its IUPAC name is N-[2-[[6-[4-(5-nitrothiophene-3-carbonyl)piperazin-1-yl]-2-phenylpyrimidin-4-yl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[6-[4-(5-nitrothiophene-3-carbonyl)piperazin-1-yl]-2-phenylpyrimidin-4-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 22353338 |
| Molecular Formula | C23H25N7O4S |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | N-[2-[[6-[4-(5-nitrothiophene-3-carbonyl)piperazin-1-yl]-2-phenylpyrimidin-4-yl]amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNc1cc(N2CCN(C(=O)c3csc([N+](=O)[O-])c3)CC2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C23H25N7O4S/c1-16(31)24-7-8-25-19-14-20(27-22(26-19)17-5-3-2-4-6-17)28-9-11-29(12-10-28)23(32)18-13-21(30(33)34)35-15-18/h2-6,13-15H,7-12H2,1H3,(H,24,31)(H,25,26,27) |
| InChIKey | XWWXFSJPIVWNLC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 133.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|