C29H31N7O2 — CID 22353421
N-[2-[[6-[4-[(E)-3-(1H-indol-3-yl)prop-2-enoyl]piperazin-1-yl]-2-phenylpyrimidin-4-yl]amino]ethyl]acetamide (PubChem CID 22353421) has the molecular formula C29H31N7O2 and a molecular weight of 509.61 g/mol. Its IUPAC name is N-[2-[[6-[4-[(E)-3-(1H-indol-3-yl)prop-2-enoyl]piperazin-1-yl]-2-phenylpyrimidin-4-yl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[6-[4-[(E)-3-(1H-indol-3-yl)prop-2-enoyl]piperazin-1-yl]-2-phenylpyrimidin-4-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 22353421 |
| Molecular Formula | C29H31N7O2 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.25 |
| IUPAC Name | N-[2-[[6-[4-[(E)-3-(1H-indol-3-yl)prop-2-enoyl]piperazin-1-yl]-2-phenylpyrimidin-4-yl]amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNc1cc(N2CCN(C(=O)/C=C/c3c[nH]c4ccccc34)CC2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C29H31N7O2/c1-21(37)30-13-14-31-26-19-27(34-29(33-26)22-7-3-2-4-8-22)35-15-17-36(18-16-35)28(38)12-11-23-20-32-25-10-6-5-9-24(23)25/h2-12,19-20,32H,13-18H2,1H3,(H,30,37)(H,31,33,34)/b12-11+ |
| InChIKey | SKWDVQPZXDBILA-VAWYXSNFSA-N |
| XLogP | 3.53 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|