C25H27ClN6O3 — CID 22379039
N-[2-[[6-[4-(5-chloro-2-hydroxybenzoyl)piperazin-1-yl]-2-phenylpyrimidin-4-yl]amino]ethyl]acetamide (PubChem CID 22379039) has the molecular formula C25H27ClN6O3 and a molecular weight of 494.98 g/mol. Its IUPAC name is N-[2-[[6-[4-(5-chloro-2-hydroxybenzoyl)piperazin-1-yl]-2-phenylpyrimidin-4-yl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[6-[4-(5-chloro-2-hydroxybenzoyl)piperazin-1-yl]-2-phenylpyrimidin-4-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 22379039 |
| Molecular Formula | C25H27ClN6O3 |
| Molecular Weight | 494.98 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | N-[2-[[6-[4-(5-chloro-2-hydroxybenzoyl)piperazin-1-yl]-2-phenylpyrimidin-4-yl]amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNc1cc(N2CCN(C(=O)c3cc(Cl)ccc3O)CC2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C25H27ClN6O3/c1-17(33)27-9-10-28-22-16-23(30-24(29-22)18-5-3-2-4-6-18)31-11-13-32(14-12-31)25(35)20-15-19(26)7-8-21(20)34/h2-8,15-16,34H,9-14H2,1H3,(H,27,33)(H,28,29,30) |
| InChIKey | GZKNKBJTNRTJNI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.98 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|