C26H29ClN6O4S — CID 22378805
N-[2-[[2-(4-chlorophenyl)-6-[4-(4-methylsulfonylbenzoyl)piperazin-1-yl]pyrimidin-4-yl]amino]ethyl]acetamide (PubChem CID 22378805) has the molecular formula C26H29ClN6O4S and a molecular weight of 557.08 g/mol. Its IUPAC name is N-[2-[[2-(4-chlorophenyl)-6-[4-(4-methylsulfonylbenzoyl)piperazin-1-yl]pyrimidin-4-yl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[2-(4-chlorophenyl)-6-[4-(4-methylsulfonylbenzoyl)piperazin-1-yl]pyrimidin-4-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 22378805 |
| Molecular Formula | C26H29ClN6O4S |
| Molecular Weight | 557.08 g/mol |
| Exact Mass | 556.17 |
| IUPAC Name | N-[2-[[2-(4-chlorophenyl)-6-[4-(4-methylsulfonylbenzoyl)piperazin-1-yl]pyrimidin-4-yl]amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNc1cc(N2CCN(C(=O)c3ccc(S(C)(=O)=O)cc3)CC2)nc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C26H29ClN6O4S/c1-18(34)28-11-12-29-23-17-24(31-25(30-23)19-3-7-21(27)8-4-19)32-13-15-33(16-14-32)26(35)20-5-9-22(10-6-20)38(2,36)37/h3-10,17H,11-16H2,1-2H3,(H,28,34)(H,29,30,31) |
| InChIKey | HJCZMJRTXYDLSM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.08 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|