C26H25ClF4N6O2 — CID 22379005
N-[2-[[2-(4-chlorophenyl)-6-[4-(2,3,5,6-tetrafluoro-4-methylbenzoyl)piperazin-1-yl]pyrimidin-4-yl]amino]ethyl]acetamide (PubChem CID 22379005) has the molecular formula C26H25ClF4N6O2 and a molecular weight of 564.97 g/mol. Its IUPAC name is N-[2-[[2-(4-chlorophenyl)-6-[4-(2,3,5,6-tetrafluoro-4-methylbenzoyl)piperazin-1-yl]pyrimidin-4-yl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[2-(4-chlorophenyl)-6-[4-(2,3,5,6-tetrafluoro-4-methylbenzoyl)piperazin-1-yl]pyrimidin-4-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 22379005 |
| Molecular Formula | C26H25ClF4N6O2 |
| Molecular Weight | 564.97 g/mol |
| Exact Mass | 564.17 |
| IUPAC Name | N-[2-[[2-(4-chlorophenyl)-6-[4-(2,3,5,6-tetrafluoro-4-methylbenzoyl)piperazin-1-yl]pyrimidin-4-yl]amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNc1cc(N2CCN(C(=O)c3c(F)c(F)c(C)c(F)c3F)CC2)nc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C26H25ClF4N6O2/c1-14-21(28)23(30)20(24(31)22(14)29)26(39)37-11-9-36(10-12-37)19-13-18(33-8-7-32-15(2)38)34-25(35-19)16-3-5-17(27)6-4-16/h3-6,13H,7-12H2,1-2H3,(H,32,38)(H,33,34,35) |
| InChIKey | XGTJWVXHYZVIBR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.97 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|