C25H27ClN8O2S — CID 22378860
N-[2-[[6-(2-acetamidoethylamino)-2-(4-chlorophenyl)pyrimidin-4-yl]amino]ethyl]-2-(1H-benzimidazol-2-ylsulfanyl)acetamide (PubChem CID 22378860) has the molecular formula C25H27ClN8O2S and a molecular weight of 539.07 g/mol. Its IUPAC name is N-[2-[[6-(2-acetamidoethylamino)-2-(4-chlorophenyl)pyrimidin-4-yl]amino]ethyl]-2-(1H-benzimidazol-2-ylsulfanyl)acetamide.
| Compound Name | N-[2-[[6-(2-acetamidoethylamino)-2-(4-chlorophenyl)pyrimidin-4-yl]amino]ethyl]-2-(1H-benzimidazol-2-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 22378860 |
| Molecular Formula | C25H27ClN8O2S |
| Molecular Weight | 539.07 g/mol |
| Exact Mass | 538.17 |
| IUPAC Name | N-[2-[[6-(2-acetamidoethylamino)-2-(4-chlorophenyl)pyrimidin-4-yl]amino]ethyl]-2-(1H-benzimidazol-2-ylsulfanyl)acetamide |
| SMILES | CC(=O)NCCNc1cc(NCCNC(=O)CSc2nc3ccccc3[nH]2)nc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C25H27ClN8O2S/c1-16(35)27-10-11-28-21-14-22(34-24(33-21)17-6-8-18(26)9-7-17)29-12-13-30-23(36)15-37-25-31-19-4-2-3-5-20(19)32-25/h2-9,14H,10-13,15H2,1H3,(H,27,35)(H,30,36)(H,31,32)(H2,28,29,33,34) |
| InChIKey | CRCMFJADOQDERE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 136.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.07 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|