C25H29ClN6O2S — CID 22378882
N-[2-[[6-(2-acetamidoethylamino)-5-methyl-2-phenylpyrimidin-4-yl]amino]ethyl]-2-(4-chlorophenyl)sulfanylacetamide (PubChem CID 22378882) has the molecular formula C25H29ClN6O2S and a molecular weight of 513.07 g/mol. Its IUPAC name is N-[2-[[6-(2-acetamidoethylamino)-5-methyl-2-phenylpyrimidin-4-yl]amino]ethyl]-2-(4-chlorophenyl)sulfanylacetamide.
| Compound Name | N-[2-[[6-(2-acetamidoethylamino)-5-methyl-2-phenylpyrimidin-4-yl]amino]ethyl]-2-(4-chlorophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 22378882 |
| Molecular Formula | C25H29ClN6O2S |
| Molecular Weight | 513.07 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | N-[2-[[6-(2-acetamidoethylamino)-5-methyl-2-phenylpyrimidin-4-yl]amino]ethyl]-2-(4-chlorophenyl)sulfanylacetamide |
| SMILES | CC(=O)NCCNc1nc(-c2ccccc2)nc(NCCNC(=O)CSc2ccc(Cl)cc2)c1C |
| InChI | InChI=1S/C25H29ClN6O2S/c1-17-23(29-14-12-27-18(2)33)31-25(19-6-4-3-5-7-19)32-24(17)30-15-13-28-22(34)16-35-21-10-8-20(26)9-11-21/h3-11H,12-16H2,1-2H3,(H,27,33)(H,28,34)(H2,29,30,31,32) |
| InChIKey | VXOVEJGHIKIKQK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 108.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.07 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|