C27H28ClN7O2 — CID 22379232
N-[2-[[6-(2-acetamidoethylamino)-2-(4-chlorophenyl)-5-methylpyrimidin-4-yl]amino]ethyl]isoquinoline-3-carboxamide (PubChem CID 22379232) has the molecular formula C27H28ClN7O2 and a molecular weight of 518.02 g/mol. Its IUPAC name is N-[2-[[6-(2-acetamidoethylamino)-2-(4-chlorophenyl)-5-methylpyrimidin-4-yl]amino]ethyl]isoquinoline-3-carboxamide.
| Compound Name | N-[2-[[6-(2-acetamidoethylamino)-2-(4-chlorophenyl)-5-methylpyrimidin-4-yl]amino]ethyl]isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 22379232 |
| Molecular Formula | C27H28ClN7O2 |
| Molecular Weight | 518.02 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | N-[2-[[6-(2-acetamidoethylamino)-2-(4-chlorophenyl)-5-methylpyrimidin-4-yl]amino]ethyl]isoquinoline-3-carboxamide |
| SMILES | CC(=O)NCCNc1nc(-c2ccc(Cl)cc2)nc(NCCNC(=O)c2cc3ccccc3cn2)c1C |
| InChI | InChI=1S/C27H28ClN7O2/c1-17-24(30-12-11-29-18(2)36)34-26(19-7-9-22(28)10-8-19)35-25(17)31-13-14-32-27(37)23-15-20-5-3-4-6-21(20)16-33-23/h3-10,15-16H,11-14H2,1-2H3,(H,29,36)(H,32,37)(H2,30,31,34,35) |
| InChIKey | PADGESHTLQQFNY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.02 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|