C26H26ClF3N6O2 — CID 68535310
(E)-N-[2-[[6-(2-acetamidoethylamino)-2-(4-chlorophenyl)-5-methylpyrimidin-4-yl]amino]ethyl]-3-(2,3,4-trifluorophenyl)prop-2-enamide (PubChem CID 68535310) has the molecular formula C26H26ClF3N6O2 and a molecular weight of 546.98 g/mol. Its IUPAC name is (E)-N-[2-[[6-(2-acetamidoethylamino)-2-(4-chlorophenyl)-5-methylpyrimidin-4-yl]amino]ethyl]-3-(2,3,4-trifluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-[[6-(2-acetamidoethylamino)-2-(4-chlorophenyl)-5-methylpyrimidin-4-yl]amino]ethyl]-3-(2,3,4-trifluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 68535310 |
| Molecular Formula | C26H26ClF3N6O2 |
| Molecular Weight | 546.98 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | (E)-N-[2-[[6-(2-acetamidoethylamino)-2-(4-chlorophenyl)-5-methylpyrimidin-4-yl]amino]ethyl]-3-(2,3,4-trifluorophenyl)prop-2-enamide |
| SMILES | CC(=O)NCCNc1nc(-c2ccc(Cl)cc2)nc(NCCNC(=O)/C=C/c2ccc(F)c(F)c2F)c1C |
| InChI | InChI=1S/C26H26ClF3N6O2/c1-15-24(33-13-11-31-16(2)37)35-26(18-3-7-19(27)8-4-18)36-25(15)34-14-12-32-21(38)10-6-17-5-9-20(28)23(30)22(17)29/h3-10H,11-14H2,1-2H3,(H,31,37)(H,32,38)(H2,33,34,35,36)/b10-6+ |
| InChIKey | HRECVDPAIFYTEC-UXBLZVDNSA-N |
| XLogP | 4.31 |
| TPSA | 108.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.98 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|