C25H30N6O4S — CID 22378852
N-[2-[[6-(2-acetamidoethylamino)-5-methyl-2-phenylpyrimidin-4-yl]amino]ethyl]-4-methylsulfonylbenzamide (PubChem CID 22378852) has the molecular formula C25H30N6O4S and a molecular weight of 510.62 g/mol. Its IUPAC name is N-[2-[[6-(2-acetamidoethylamino)-5-methyl-2-phenylpyrimidin-4-yl]amino]ethyl]-4-methylsulfonylbenzamide.
| Compound Name | N-[2-[[6-(2-acetamidoethylamino)-5-methyl-2-phenylpyrimidin-4-yl]amino]ethyl]-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 22378852 |
| Molecular Formula | C25H30N6O4S |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | N-[2-[[6-(2-acetamidoethylamino)-5-methyl-2-phenylpyrimidin-4-yl]amino]ethyl]-4-methylsulfonylbenzamide |
| SMILES | CC(=O)NCCNc1nc(-c2ccccc2)nc(NCCNC(=O)c2ccc(S(C)(=O)=O)cc2)c1C |
| InChI | InChI=1S/C25H30N6O4S/c1-17-22(27-14-13-26-18(2)32)30-24(19-7-5-4-6-8-19)31-23(17)28-15-16-29-25(33)20-9-11-21(12-10-20)36(3,34)35/h4-12H,13-16H2,1-3H3,(H,26,32)(H,29,33)(H2,27,28,30,31) |
| InChIKey | ADHUEIFULHQRGK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 142.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|