C21H25N9O4 — CID 22353404
N-[2-[[6-(2-acetamidoethylamino)-5-methyl-2-phenylpyrimidin-4-yl]amino]ethyl]-4-nitro-1H-pyrazole-5-carboxamide (PubChem CID 22353404) has the molecular formula C21H25N9O4 and a molecular weight of 467.49 g/mol. Its IUPAC name is N-[2-[[6-(2-acetamidoethylamino)-5-methyl-2-phenylpyrimidin-4-yl]amino]ethyl]-4-nitro-1H-pyrazole-5-carboxamide.
| Compound Name | N-[2-[[6-(2-acetamidoethylamino)-5-methyl-2-phenylpyrimidin-4-yl]amino]ethyl]-4-nitro-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 22353404 |
| Molecular Formula | C21H25N9O4 |
| Molecular Weight | 467.49 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | N-[2-[[6-(2-acetamidoethylamino)-5-methyl-2-phenylpyrimidin-4-yl]amino]ethyl]-4-nitro-1H-pyrazole-5-carboxamide |
| SMILES | CC(=O)NCCNc1nc(-c2ccccc2)nc(NCCNC(=O)c2[nH]ncc2[N+](=O)[O-])c1C |
| InChI | InChI=1S/C21H25N9O4/c1-13-18(23-9-8-22-14(2)31)27-20(15-6-4-3-5-7-15)28-19(13)24-10-11-25-21(32)17-16(30(33)34)12-26-29-17/h3-7,12H,8-11H2,1-2H3,(H,22,31)(H,25,32)(H,26,29)(H2,23,24,27,28) |
| InChIKey | DZMKLRXPQVVKFX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 179.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.49 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|