C30H38N6O2 — CID 68537128
N-[2-[[6-(2-acetamidoethylamino)-5-methyl-2-phenylpyrimidin-4-yl]amino]ethyl]-4-cyclohexylbenzamide (PubChem CID 68537128) has the molecular formula C30H38N6O2 and a molecular weight of 514.67 g/mol. Its IUPAC name is N-[2-[[6-(2-acetamidoethylamino)-5-methyl-2-phenylpyrimidin-4-yl]amino]ethyl]-4-cyclohexylbenzamide.
| Compound Name | N-[2-[[6-(2-acetamidoethylamino)-5-methyl-2-phenylpyrimidin-4-yl]amino]ethyl]-4-cyclohexylbenzamide |
|---|---|
| PubChem CID | 68537128 |
| Molecular Formula | C30H38N6O2 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.31 |
| IUPAC Name | N-[2-[[6-(2-acetamidoethylamino)-5-methyl-2-phenylpyrimidin-4-yl]amino]ethyl]-4-cyclohexylbenzamide |
| SMILES | CC(=O)NCCNc1nc(-c2ccccc2)nc(NCCNC(=O)c2ccc(C3CCCCC3)cc2)c1C |
| InChI | InChI=1S/C30H38N6O2/c1-21-27(32-18-17-31-22(2)37)35-29(25-11-7-4-8-12-25)36-28(21)33-19-20-34-30(38)26-15-13-24(14-16-26)23-9-5-3-6-10-23/h4,7-8,11-16,23H,3,5-6,9-10,17-20H2,1-2H3,(H,31,37)(H,34,38)(H2,32,33,35,36) |
| InChIKey | ILJOLVPRMPNENU-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 108.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|