C26H26ClN7O2 — CID 22378995
N-[2-[[6-(2-acetamidoethylamino)-2-(4-chlorophenyl)pyrimidin-4-yl]amino]ethyl]isoquinoline-3-carboxamide (PubChem CID 22378995) has the molecular formula C26H26ClN7O2 and a molecular weight of 503.99 g/mol. Its IUPAC name is N-[2-[[6-(2-acetamidoethylamino)-2-(4-chlorophenyl)pyrimidin-4-yl]amino]ethyl]isoquinoline-3-carboxamide.
| Compound Name | N-[2-[[6-(2-acetamidoethylamino)-2-(4-chlorophenyl)pyrimidin-4-yl]amino]ethyl]isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 22378995 |
| Molecular Formula | C26H26ClN7O2 |
| Molecular Weight | 503.99 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | N-[2-[[6-(2-acetamidoethylamino)-2-(4-chlorophenyl)pyrimidin-4-yl]amino]ethyl]isoquinoline-3-carboxamide |
| SMILES | CC(=O)NCCNc1cc(NCCNC(=O)c2cc3ccccc3cn2)nc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C26H26ClN7O2/c1-17(35)28-10-11-29-23-15-24(34-25(33-23)18-6-8-21(27)9-7-18)30-12-13-31-26(36)22-14-19-4-2-3-5-20(19)16-32-22/h2-9,14-16H,10-13H2,1H3,(H,28,35)(H,31,36)(H2,29,30,33,34) |
| InChIKey | BWFVNCQBBHTGGX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.99 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|