C28H35N7O3 — CID 174464795
N-[2-[2-(2-acetamidoethylamino)phenyl]pyrimidin-4-yl]-2-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]acetamide (PubChem CID 174464795) has the molecular formula C28H35N7O3 and a molecular weight of 517.63 g/mol. Its IUPAC name is N-[2-[2-(2-acetamidoethylamino)phenyl]pyrimidin-4-yl]-2-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]acetamide.
| Compound Name | N-[2-[2-(2-acetamidoethylamino)phenyl]pyrimidin-4-yl]-2-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 174464795 |
| Molecular Formula | C28H35N7O3 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.28 |
| IUPAC Name | N-[2-[2-(2-acetamidoethylamino)phenyl]pyrimidin-4-yl]-2-[4-[(4-methoxyphenyl)methyl]piperazin-1-yl]acetamide |
| SMILES | COc1ccc(CN2CCN(CC(=O)Nc3ccnc(-c4ccccc4NCCNC(C)=O)n3)CC2)cc1 |
| InChI | InChI=1S/C28H35N7O3/c1-21(36)29-13-14-30-25-6-4-3-5-24(25)28-31-12-11-26(33-28)32-27(37)20-35-17-15-34(16-18-35)19-22-7-9-23(38-2)10-8-22/h3-12,30H,13-20H2,1-2H3,(H,29,36)(H,31,32,33,37) |
| InChIKey | JGUFNJUUXCSFHE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|