C19H25NO4 — CID 76543369
methyl 6-[5-(4-methoxyphenyl)penta-2,4-dienoylamino]hexanoate (PubChem CID 76543369) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is methyl 6-[5-(4-methoxyphenyl)penta-2,4-dienoylamino]hexanoate.
| Compound Name | methyl 6-[5-(4-methoxyphenyl)penta-2,4-dienoylamino]hexanoate |
|---|---|
| PubChem CID | 76543369 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | methyl 6-[5-(4-methoxyphenyl)penta-2,4-dienoylamino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)C=CC=Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C19H25NO4/c1-23-17-13-11-16(12-14-17)8-5-6-9-18(21)20-15-7-3-4-10-19(22)24-2/h5-6,8-9,11-14H,3-4,7,10,15H2,1-2H3,(H,20,21) |
| InChIKey | XAQKOOVRAVEZQI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|