C17H27N2O2+ — CID 90891358
ethyl-[3-[3-(4-methoxyphenyl)prop-2-enoylamino]propyl]-dimethylazanium (PubChem CID 90891358) has the molecular formula C17H27N2O2+ and a molecular weight of 291.42 g/mol. Its IUPAC name is ethyl-[3-[3-(4-methoxyphenyl)prop-2-enoylamino]propyl]-dimethylazanium.
| Compound Name | ethyl-[3-[3-(4-methoxyphenyl)prop-2-enoylamino]propyl]-dimethylazanium |
|---|---|
| PubChem CID | 90891358 |
| Molecular Formula | C17H27N2O2+ |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | ethyl-[3-[3-(4-methoxyphenyl)prop-2-enoylamino]propyl]-dimethylazanium |
| SMILES | CC[N+](C)(C)CCCNC(=O)C=Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C17H26N2O2/c1-5-19(2,3)14-6-13-18-17(20)12-9-15-7-10-16(21-4)11-8-15/h7-12H,5-6,13-14H2,1-4H3/p+1 |
| InChIKey | AZSOKPQBLLPQSH-UHFFFAOYSA-O |
| XLogP | 2.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|