C37H59N3O2 — CID 102463139
3,5-ditert-butyl-N-[2-[5-[(3,5-ditert-butylphenyl)methylamino]pentanoylamino]ethyl]benzamide (PubChem CID 102463139) has the molecular formula C37H59N3O2 and a molecular weight of 577.90 g/mol. Its IUPAC name is 3,5-ditert-butyl-N-[2-[5-[(3,5-ditert-butylphenyl)methylamino]pentanoylamino]ethyl]benzamide.
| Compound Name | 3,5-ditert-butyl-N-[2-[5-[(3,5-ditert-butylphenyl)methylamino]pentanoylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 102463139 |
| Molecular Formula | C37H59N3O2 |
| Molecular Weight | 577.90 g/mol |
| Exact Mass | 577.46 |
| IUPAC Name | 3,5-ditert-butyl-N-[2-[5-[(3,5-ditert-butylphenyl)methylamino]pentanoylamino]ethyl]benzamide |
| SMILES | CC(C)(C)c1cc(CNCCCCC(=O)NCCNC(=O)c2cc(C(C)(C)C)cc(C(C)(C)C)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C37H59N3O2/c1-34(2,3)28-19-26(20-29(23-28)35(4,5)6)25-38-16-14-13-15-32(41)39-17-18-40-33(42)27-21-30(36(7,8)9)24-31(22-27)37(10,11)12/h19-24,38H,13-18,25H2,1-12H3,(H,39,41)(H,40,42) |
| InChIKey | GTDLGWGPSBHOMR-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.90 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|