C22H30N2O — CID 118398481
2-[(4-tert-butylphenyl)methylamino]-N-(3-phenylpropyl)acetamide (PubChem CID 118398481) has the molecular formula C22H30N2O and a molecular weight of 338.50 g/mol. Its IUPAC name is 2-[(4-tert-butylphenyl)methylamino]-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-[(4-tert-butylphenyl)methylamino]-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 118398481 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | 2-[(4-tert-butylphenyl)methylamino]-N-(3-phenylpropyl)acetamide |
| SMILES | CC(C)(C)c1ccc(CNCC(=O)NCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H30N2O/c1-22(2,3)20-13-11-19(12-14-20)16-23-17-21(25)24-15-7-10-18-8-5-4-6-9-18/h4-6,8-9,11-14,23H,7,10,15-17H2,1-3H3,(H,24,25) |
| InChIKey | BFULXRCZYLFUOA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|