C12H17N5 — CID 54884726
N,N-dimethyl-4-[(1H-1,2,4-triazol-5-ylmethylamino)methyl]aniline (PubChem CID 54884726) has the molecular formula C12H17N5 and a molecular weight of 231.30 g/mol. Its IUPAC name is N,N-dimethyl-4-[(1H-1,2,4-triazol-5-ylmethylamino)methyl]aniline.
| Compound Name | N,N-dimethyl-4-[(1H-1,2,4-triazol-5-ylmethylamino)methyl]aniline |
|---|---|
| PubChem CID | 54884726 |
| Molecular Formula | C12H17N5 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | N,N-dimethyl-4-[(1H-1,2,4-triazol-5-ylmethylamino)methyl]aniline |
| SMILES | CN(C)c1ccc(CNCc2ncn[nH]2)cc1 |
| InChI | InChI=1S/C12H17N5/c1-17(2)11-5-3-10(4-6-11)7-13-8-12-14-9-15-16-12/h3-6,9,13H,7-8H2,1-2H3,(H,14,15,16) |
| InChIKey | PXDNNZBRVOCNGS-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|