C16H26N4 — CID 82337057
N-[2-(1H-benzimidazol-2-yl)ethyl]-N',N'-diethylpropane-1,3-diamine (PubChem CID 82337057) has the molecular formula C16H26N4 and a molecular weight of 274.41 g/mol. Its IUPAC name is N-[2-(1H-benzimidazol-2-yl)ethyl]-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-[2-(1H-benzimidazol-2-yl)ethyl]-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 82337057 |
| Molecular Formula | C16H26N4 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.22 |
| IUPAC Name | N-[2-(1H-benzimidazol-2-yl)ethyl]-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCNCCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H26N4/c1-3-20(4-2)13-7-11-17-12-10-16-18-14-8-5-6-9-15(14)19-16/h5-6,8-9,17H,3-4,7,10-13H2,1-2H3,(H,18,19) |
| InChIKey | RJNMJYQHDAHTSA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|