C20H25N3O3 — CID 66528592
3-(1H-benzimidazol-2-yl)-N-[(2,3,4-trimethoxyphenyl)methyl]propan-1-amine (PubChem CID 66528592) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is 3-(1H-benzimidazol-2-yl)-N-[(2,3,4-trimethoxyphenyl)methyl]propan-1-amine.
| Compound Name | 3-(1H-benzimidazol-2-yl)-N-[(2,3,4-trimethoxyphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 66528592 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 3-(1H-benzimidazol-2-yl)-N-[(2,3,4-trimethoxyphenyl)methyl]propan-1-amine |
| SMILES | COc1ccc(CNCCCc2nc3ccccc3[nH]2)c(OC)c1OC |
| InChI | InChI=1S/C20H25N3O3/c1-24-17-11-10-14(19(25-2)20(17)26-3)13-21-12-6-9-18-22-15-7-4-5-8-16(15)23-18/h4-5,7-8,10-11,21H,6,9,12-13H2,1-3H3,(H,22,23) |
| InChIKey | SXRNBVORKOKXSX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 68.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|