C20H13N3O2 — CID 135464411
3-(2H-chromen-3-yl)-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile (PubChem CID 135464411) has the molecular formula C20H13N3O2 and a molecular weight of 327.34 g/mol. Its IUPAC name is 3-(2H-chromen-3-yl)-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile.
| Compound Name | 3-(2H-chromen-3-yl)-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 135464411 |
| Molecular Formula | C20H13N3O2 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 3-(2H-chromen-3-yl)-2-(4-oxo-3H-quinazolin-2-yl)prop-2-enenitrile |
| SMILES | N#CC(=CC1=Cc2ccccc2OC1)c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C20H13N3O2/c21-11-15(10-13-9-14-5-1-4-8-18(14)25-12-13)19-22-17-7-3-2-6-16(17)20(24)23-19/h1-10H,12H2,(H,22,23,24) |
| InChIKey | WHAZUQGGVOEBSI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|