C19H19N4OS+ — CID 135761755
(Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[(2S)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]but-2-enenitrile (PubChem CID 135761755) has the molecular formula C19H19N4OS+ and a molecular weight of 351.46 g/mol. Its IUPAC name is (Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[(2S)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]but-2-enenitrile.
| Compound Name | (Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[(2S)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]but-2-enenitrile |
|---|---|
| PubChem CID | 135761755 |
| Molecular Formula | C19H19N4OS+ |
| Molecular Weight | 351.46 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | (Z)-2-(1H-benzimidazol-2-yl)-3-hydroxy-4-[(2S)-2-thiophen-2-ylpyrrolidin-1-ium-1-yl]but-2-enenitrile |
| SMILES | N#C/C(=C(/O)C[NH+]1CCC[C@H]1c1cccs1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H18N4OS/c20-11-13(19-21-14-5-1-2-6-15(14)22-19)17(24)12-23-9-3-7-16(23)18-8-4-10-25-18/h1-2,4-6,8,10,16,24H,3,7,9,12H2,(H,21,22)/p+1/b17-13-/t16-/m0/s1 |
| InChIKey | GGQGQWHZMMBTEV-MUBYSKIDSA-O |
| XLogP | 2.84 |
| TPSA | 77.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|