C23H14ClN3O2 — CID 135562918
(Z)-2-(1H-benzimidazol-2-yl)-3-[2-(4-chlorobenzoyl)phenyl]-3-hydroxyprop-2-enenitrile (PubChem CID 135562918) has the molecular formula C23H14ClN3O2 and a molecular weight of 399.84 g/mol. Its IUPAC name is (Z)-2-(1H-benzimidazol-2-yl)-3-[2-(4-chlorobenzoyl)phenyl]-3-hydroxyprop-2-enenitrile.
| Compound Name | (Z)-2-(1H-benzimidazol-2-yl)-3-[2-(4-chlorobenzoyl)phenyl]-3-hydroxyprop-2-enenitrile |
|---|---|
| PubChem CID | 135562918 |
| Molecular Formula | C23H14ClN3O2 |
| Molecular Weight | 399.84 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | (Z)-2-(1H-benzimidazol-2-yl)-3-[2-(4-chlorobenzoyl)phenyl]-3-hydroxyprop-2-enenitrile |
| SMILES | N#C/C(=C(/O)c1ccccc1C(=O)c1ccc(Cl)cc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C23H14ClN3O2/c24-15-11-9-14(10-12-15)21(28)16-5-1-2-6-17(16)22(29)18(13-25)23-26-19-7-3-4-8-20(19)27-23/h1-12,29H,(H,26,27)/b22-18- |
| InChIKey | VLULOLOJRMCVKG-PYCFMQQDSA-N |
| XLogP | 5.40 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.84 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|