C23H20FNO3 — CID 7229070
[2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 2-phenylbenzoate (PubChem CID 7229070) has the molecular formula C23H20FNO3 and a molecular weight of 377.42 g/mol. Its IUPAC name is [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 2-phenylbenzoate.
| Compound Name | [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 2-phenylbenzoate |
|---|---|
| PubChem CID | 7229070 |
| Molecular Formula | C23H20FNO3 |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | [2-[2-(4-fluorophenyl)ethylamino]-2-oxoethyl] 2-phenylbenzoate |
| SMILES | O=C(COC(=O)c1ccccc1-c1ccccc1)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C23H20FNO3/c24-19-12-10-17(11-13-19)14-15-25-22(26)16-28-23(27)21-9-5-4-8-20(21)18-6-2-1-3-7-18/h1-13H,14-16H2,(H,25,26) |
| InChIKey | OCHCRJKHIPGRQI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |